C20H23F3N4S — CID 139346442
N-[1-(2-aminoethyl)piperidin-4-yl]-1-(trifluoromethyl)-10H-phenothiazin-3-amine (PubChem CID 139346442) has the molecular formula C20H23F3N4S and a molecular weight of 408.49 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)piperidin-4-yl]-1-(trifluoromethyl)-10H-phenothiazin-3-amine.
| Compound Name | N-[1-(2-aminoethyl)piperidin-4-yl]-1-(trifluoromethyl)-10H-phenothiazin-3-amine |
|---|---|
| PubChem CID | 139346442 |
| Molecular Formula | C20H23F3N4S |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[1-(2-aminoethyl)piperidin-4-yl]-1-(trifluoromethyl)-10H-phenothiazin-3-amine |
| SMILES | NCCN1CCC(Nc2cc3c(c(C(F)(F)F)c2)Nc2ccccc2S3)CC1 |
| InChI | InChI=1S/C20H23F3N4S/c21-20(22,23)15-11-14(25-13-5-8-27(9-6-13)10-7-24)12-18-19(15)26-16-3-1-2-4-17(16)28-18/h1-4,11-13,25-26H,5-10,24H2 |
| InChIKey | DRJVSXOWUCNLIX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|