C21H29N5OS — CID 145422295
1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carbaldehyde;methanamine (PubChem CID 145422295) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carbaldehyde;methanamine.
| Compound Name | 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 145422295 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carbaldehyde;methanamine |
| SMILES | CN.NCCN1CCC(Nc2cc(C=O)cc3c2Nc2ccccc2S3)CC1 |
| InChI | InChI=1S/C20H24N4OS.CH5N/c21-7-10-24-8-5-15(6-9-24)22-17-11-14(13-25)12-19-20(17)23-16-3-1-2-4-18(16)26-19;1-2/h1-4,11-13,15,22-23H,5-10,21H2;2H2,1H3 |
| InChIKey | BLYXAFSAAYNSRG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|