C20H26ClN5OS — CID 139346604
1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carboxamide;hydrochloride (PubChem CID 139346604) has the molecular formula C20H26ClN5OS and a molecular weight of 419.98 g/mol. Its IUPAC name is 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carboxamide;hydrochloride.
| Compound Name | 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139346604 |
| Molecular Formula | C20H26ClN5OS |
| Molecular Weight | 419.98 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-[[1-(2-aminoethyl)piperidin-4-yl]amino]-10H-phenothiazine-3-carboxamide;hydrochloride |
| SMILES | Cl.NCCN1CCC(Nc2cc(C(N)=O)cc3c2Nc2ccccc2S3)CC1 |
| InChI | InChI=1S/C20H25N5OS.ClH/c21-7-10-25-8-5-14(6-9-25)23-16-11-13(20(22)26)12-18-19(16)24-15-3-1-2-4-17(15)27-18;/h1-4,11-12,14,23-24H,5-10,21H2,(H2,22,26);1H |
| InChIKey | MLSLIMONJWAAMW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.98 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |