C12H13F4N3O — CID 74233216
1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[(3R)-pyrrolidin-3-yl]urea (PubChem CID 74233216) has the molecular formula C12H13F4N3O and a molecular weight of 291.25 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[(3R)-pyrrolidin-3-yl]urea.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[(3R)-pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 74233216 |
| Molecular Formula | C12H13F4N3O |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-[(3R)-pyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1F)N[C@@H]1CCNC1 |
| InChI | InChI=1S/C12H13F4N3O/c13-9-2-1-7(12(14,15)16)5-10(9)19-11(20)18-8-3-4-17-6-8/h1-2,5,8,17H,3-4,6H2,(H2,18,19,20)/t8-/m1/s1 |
| InChIKey | PFBQGNMBRIJWGF-MRVPVSSYSA-N |
| XLogP | 2.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |