C12H14Cl2F3N3O — CID 165430475
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(3S)-pyrrolidin-3-yl]urea;hydrochloride (PubChem CID 165430475) has the molecular formula C12H14Cl2F3N3O and a molecular weight of 344.16 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(3S)-pyrrolidin-3-yl]urea;hydrochloride.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(3S)-pyrrolidin-3-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 165430475 |
| Molecular Formula | C12H14Cl2F3N3O |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(3S)-pyrrolidin-3-yl]urea;hydrochloride |
| SMILES | Cl.O=C(Nc1cc(C(F)(F)F)ccc1Cl)N[C@H]1CCNC1 |
| InChI | InChI=1S/C12H13ClF3N3O.ClH/c13-9-2-1-7(12(14,15)16)5-10(9)19-11(20)18-8-3-4-17-6-8;/h1-2,5,8,17H,3-4,6H2,(H2,18,19,20);1H/t8-;/m0./s1 |
| InChIKey | QZFRRFZZLVIQNK-QRPNPIFTSA-N |
| XLogP | 3.26 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |