C11H8Br2ClF3N2O2 — CID 21423298
2,3-dibromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]propanamide (PubChem CID 21423298) has the molecular formula C11H8Br2ClF3N2O2 and a molecular weight of 452.45 g/mol. Its IUPAC name is 2,3-dibromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]propanamide.
| Compound Name | 2,3-dibromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]propanamide |
|---|---|
| PubChem CID | 21423298 |
| Molecular Formula | C11H8Br2ClF3N2O2 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 449.86 |
| IUPAC Name | 2,3-dibromo-N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]propanamide |
| SMILES | O=C(NC(=O)C(Br)CBr)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H8Br2ClF3N2O2/c12-4-6(13)9(20)19-10(21)18-8-3-5(11(15,16)17)1-2-7(8)14/h1-3,6H,4H2,(H2,18,19,20,21) |
| InChIKey | AHNBHXWTCQYYEY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|