C11H8ClF3N4O2 — CID 4689522
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(2-cyanoacetyl)amino]urea (PubChem CID 4689522) has the molecular formula C11H8ClF3N4O2 and a molecular weight of 320.66 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(2-cyanoacetyl)amino]urea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(2-cyanoacetyl)amino]urea |
|---|---|
| PubChem CID | 4689522 |
| Molecular Formula | C11H8ClF3N4O2 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(2-cyanoacetyl)amino]urea |
| SMILES | N#CCC(=O)NNC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H8ClF3N4O2/c12-7-2-1-6(11(13,14)15)5-8(7)17-10(21)19-18-9(20)3-4-16/h1-2,5H,3H2,(H,18,20)(H2,17,19,21) |
| InChIKey | LWQYEBIZKUEHQG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|