C10H6F3IN2O — CID 168524104
2-cyano-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 168524104) has the molecular formula C10H6F3IN2O and a molecular weight of 354.07 g/mol. Its IUPAC name is 2-cyano-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 168524104 |
| Molecular Formula | C10H6F3IN2O |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-cyano-N-[2-iodo-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(C(F)(F)F)cc1I |
| InChI | InChI=1S/C10H6F3IN2O/c11-10(12,13)6-1-2-8(7(14)5-6)16-9(17)3-4-15/h1-2,5H,3H2,(H,16,17) |
| InChIKey | CBPAODDZGWJKOJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|