C12H15ClF3N3O — CID 108988234
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethyl]urea (PubChem CID 108988234) has the molecular formula C12H15ClF3N3O and a molecular weight of 309.72 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 108988234 |
| Molecular Formula | C12H15ClF3N3O |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[2-(dimethylamino)ethyl]urea |
| SMILES | CN(C)CCNC(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H15ClF3N3O/c1-19(2)6-5-17-11(20)18-10-7-8(12(14,15)16)3-4-9(10)13/h3-4,7H,5-6H2,1-2H3,(H2,17,18,20) |
| InChIKey | BTBQQPVHVNDQHJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |