C11H12ClF3N2O — CID 28567503
2-[2-chloro-5-(trifluoromethyl)anilino]-N,N-dimethylacetamide (PubChem CID 28567503) has the molecular formula C11H12ClF3N2O and a molecular weight of 280.68 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)anilino]-N,N-dimethylacetamide.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)anilino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 28567503 |
| Molecular Formula | C11H12ClF3N2O |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)anilino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O/c1-17(2)10(18)6-16-9-5-7(11(13,14)15)3-4-8(9)12/h3-5,16H,6H2,1-2H3 |
| InChIKey | PPWKJPRXYZCGSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |