C13H15ClF3N3O — CID 165430468
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-piperidin-3-ylurea (PubChem CID 165430468) has the molecular formula C13H15ClF3N3O and a molecular weight of 321.73 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-piperidin-3-ylurea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-piperidin-3-ylurea |
|---|---|
| PubChem CID | 165430468 |
| Molecular Formula | C13H15ClF3N3O |
| Molecular Weight | 321.73 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-piperidin-3-ylurea |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)NC1CCCNC1 |
| InChI | InChI=1S/C13H15ClF3N3O/c14-10-4-3-8(13(15,16)17)6-11(10)20-12(21)19-9-2-1-5-18-7-9/h3-4,6,9,18H,1-2,5,7H2,(H2,19,20,21) |
| InChIKey | BAQFMDVCCFFZJN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.73 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |