C15H12BrClFN — CID 107632769
N-(2-bromo-5-fluorophenyl)-5-chloro-2,3-dihydro-1H-inden-2-amine (PubChem CID 107632769) has the molecular formula C15H12BrClFN and a molecular weight of 340.62 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-5-chloro-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(2-bromo-5-fluorophenyl)-5-chloro-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 107632769 |
| Molecular Formula | C15H12BrClFN |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-5-chloro-2,3-dihydro-1H-inden-2-amine |
| SMILES | Fc1ccc(Br)c(NC2Cc3ccc(Cl)cc3C2)c1 |
| InChI | InChI=1S/C15H12BrClFN/c16-14-4-3-12(18)8-15(14)19-13-6-9-1-2-11(17)5-10(9)7-13/h1-5,8,13,19H,6-7H2 |
| InChIKey | XTDRVTRYSUEZPO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |