C17H14FN3 — CID 86305598
N-(2,3-dihydro-1H-inden-2-yl)-6-fluoroquinazolin-4-amine (PubChem CID 86305598) has the molecular formula C17H14FN3 and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-2-yl)-6-fluoroquinazolin-4-amine.
| Compound Name | N-(2,3-dihydro-1H-inden-2-yl)-6-fluoroquinazolin-4-amine |
|---|---|
| PubChem CID | 86305598 |
| Molecular Formula | C17H14FN3 |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-2-yl)-6-fluoroquinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NC3Cc4ccccc4C3)c2c1 |
| InChI | InChI=1S/C17H14FN3/c18-13-5-6-16-15(9-13)17(20-10-19-16)21-14-7-11-3-1-2-4-12(11)8-14/h1-6,9-10,14H,7-8H2,(H,19,20,21) |
| InChIKey | BRNNACJZEHPFJY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |