C16H14FN5 — CID 146079954
6-fluoro-N-(1-pyridin-2-ylazetidin-3-yl)quinazolin-4-amine (PubChem CID 146079954) has the molecular formula C16H14FN5 and a molecular weight of 295.32 g/mol. Its IUPAC name is 6-fluoro-N-(1-pyridin-2-ylazetidin-3-yl)quinazolin-4-amine.
| Compound Name | 6-fluoro-N-(1-pyridin-2-ylazetidin-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 146079954 |
| Molecular Formula | C16H14FN5 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 6-fluoro-N-(1-pyridin-2-ylazetidin-3-yl)quinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NC3CN(c4ccccn4)C3)c2c1 |
| InChI | InChI=1S/C16H14FN5/c17-11-4-5-14-13(7-11)16(20-10-19-14)21-12-8-22(9-12)15-3-1-2-6-18-15/h1-7,10,12H,8-9H2,(H,19,20,21) |
| InChIKey | ALHKZDPFJMSAHK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |