C18H16F4N6 — CID 126853599
6-fluoro-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]quinazolin-4-amine (PubChem CID 126853599) has the molecular formula C18H16F4N6 and a molecular weight of 392.36 g/mol. Its IUPAC name is 6-fluoro-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]quinazolin-4-amine.
| Compound Name | 6-fluoro-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 126853599 |
| Molecular Formula | C18H16F4N6 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-fluoro-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]quinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NC3CCN(c4cc(C(F)(F)F)ncn4)CC3)c2c1 |
| InChI | InChI=1S/C18H16F4N6/c19-11-1-2-14-13(7-11)17(26-9-23-14)27-12-3-5-28(6-4-12)16-8-15(18(20,21)22)24-10-25-16/h1-2,7-10,12H,3-6H2,(H,23,26,27) |
| InChIKey | MNJRXUNYIZBDBH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |