C18H23FN4O — CID 171359747
6-fluoro-N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]quinazolin-4-amine (PubChem CID 171359747) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is 6-fluoro-N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]quinazolin-4-amine.
| Compound Name | 6-fluoro-N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 171359747 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 6-fluoro-N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]quinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NC3CCN(C[C@H]4CCOC4)CC3)c2c1 |
| InChI | InChI=1S/C18H23FN4O/c19-14-1-2-17-16(9-14)18(21-12-20-17)22-15-3-6-23(7-4-15)10-13-5-8-24-11-13/h1-2,9,12-13,15H,3-8,10-11H2,(H,20,21,22)/t13-/m1/s1 |
| InChIKey | HWWGLUGKMFDSGJ-CYBMUJFWSA-N |
| XLogP | 2.68 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |