C17H24N4O — CID 125135997
N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-amine (PubChem CID 125135997) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-amine.
| Compound Name | N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 125135997 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[1-[[(3R)-oxolan-3-yl]methyl]piperidin-4-yl]-1H-benzimidazol-2-amine |
| SMILES | c1ccc2[nH]c(NC3CCN(C[C@H]4CCOC4)CC3)nc2c1 |
| InChI | InChI=1S/C17H24N4O/c1-2-4-16-15(3-1)19-17(20-16)18-14-5-8-21(9-6-14)11-13-7-10-22-12-13/h1-4,13-14H,5-12H2,(H2,18,19,20)/t13-/m1/s1 |
| InChIKey | VTZUFFAEKRBFII-CYBMUJFWSA-N |
| XLogP | 2.48 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |