C15H21N3 — CID 46784683
N-cyclooctyl-1H-benzimidazol-2-amine (PubChem CID 46784683) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-cyclooctyl-1H-benzimidazol-2-amine.
| Compound Name | N-cyclooctyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 46784683 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-cyclooctyl-1H-benzimidazol-2-amine |
| SMILES | c1ccc2[nH]c(NC3CCCCCCC3)nc2c1 |
| InChI | InChI=1S/C15H21N3/c1-2-4-8-12(9-5-3-1)16-15-17-13-10-6-7-11-14(13)18-15/h6-7,10-12H,1-5,8-9H2,(H2,16,17,18) |
| InChIKey | HNPJKLZRTMMCMX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |