C17H17N3 — CID 25157552
N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-amine (PubChem CID 25157552) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-amine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 25157552 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-benzimidazol-2-amine |
| SMILES | c1ccc2c(c1)CCC(Nc1nc3ccccc3[nH]1)C2 |
| InChI | InChI=1S/C17H17N3/c1-2-6-13-11-14(10-9-12(13)5-1)18-17-19-15-7-3-4-8-16(15)20-17/h1-8,14H,9-11H2,(H2,18,19,20) |
| InChIKey | FGAKCRQRJSMKLI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |