C12H17ClN4 — CID 71637322
N-[(3R)-piperidin-3-yl]-1H-benzimidazol-2-amine;hydrochloride (PubChem CID 71637322) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is N-[(3R)-piperidin-3-yl]-1H-benzimidazol-2-amine;hydrochloride.
| Compound Name | N-[(3R)-piperidin-3-yl]-1H-benzimidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71637322 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(3R)-piperidin-3-yl]-1H-benzimidazol-2-amine;hydrochloride |
| SMILES | Cl.c1ccc2[nH]c(N[C@@H]3CCCNC3)nc2c1 |
| InChI | InChI=1S/C12H16N4.ClH/c1-2-6-11-10(5-1)15-12(16-11)14-9-4-3-7-13-8-9;/h1-2,5-6,9,13H,3-4,7-8H2,(H2,14,15,16);1H/t9-;/m1./s1 |
| InChIKey | GAVMXUFPKSPAFM-SBSPUUFOSA-N |
| XLogP | 2.15 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |