C14H19N5 — CID 71642523
2-N-methyl-3-N-[(3R)-piperidin-3-yl]quinoxaline-2,3-diamine (PubChem CID 71642523) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-N-methyl-3-N-[(3R)-piperidin-3-yl]quinoxaline-2,3-diamine.
| Compound Name | 2-N-methyl-3-N-[(3R)-piperidin-3-yl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 71642523 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-N-methyl-3-N-[(3R)-piperidin-3-yl]quinoxaline-2,3-diamine |
| SMILES | CNc1nc2ccccc2nc1N[C@@H]1CCCNC1 |
| InChI | InChI=1S/C14H19N5/c1-15-13-14(17-10-5-4-8-16-9-10)19-12-7-3-2-6-11(12)18-13/h2-3,6-7,10,16H,4-5,8-9H2,1H3,(H,15,18)(H,17,19)/t10-/m1/s1 |
| InChIKey | LGKYZFPRAQYDIZ-SNVBAGLBSA-N |
| XLogP | 1.84 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |