C16H20N4O — CID 71637298
N-cyclopropyl-3-[(3R)-piperidin-3-yl]oxyquinoxalin-2-amine (PubChem CID 71637298) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-cyclopropyl-3-[(3R)-piperidin-3-yl]oxyquinoxalin-2-amine.
| Compound Name | N-cyclopropyl-3-[(3R)-piperidin-3-yl]oxyquinoxalin-2-amine |
|---|---|
| PubChem CID | 71637298 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-cyclopropyl-3-[(3R)-piperidin-3-yl]oxyquinoxalin-2-amine |
| SMILES | c1ccc2nc(O[C@@H]3CCCNC3)c(NC3CC3)nc2c1 |
| InChI | InChI=1S/C16H20N4O/c1-2-6-14-13(5-1)19-15(18-11-7-8-11)16(20-14)21-12-4-3-9-17-10-12/h1-2,5-6,11-12,17H,3-4,7-10H2,(H,18,19)/t12-/m1/s1 |
| InChIKey | YZLIHMXAYPLJAP-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |