C15H21N5 — CID 71642503
2-N,3-N-dimethyl-3-N-[(3S)-piperidin-3-yl]quinoxaline-2,3-diamine (PubChem CID 71642503) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-N,3-N-dimethyl-3-N-[(3S)-piperidin-3-yl]quinoxaline-2,3-diamine.
| Compound Name | 2-N,3-N-dimethyl-3-N-[(3S)-piperidin-3-yl]quinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 71642503 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-N,3-N-dimethyl-3-N-[(3S)-piperidin-3-yl]quinoxaline-2,3-diamine |
| SMILES | CNc1nc2ccccc2nc1N(C)[C@H]1CCCNC1 |
| InChI | InChI=1S/C15H21N5/c1-16-14-15(20(2)11-6-5-9-17-10-11)19-13-8-4-3-7-12(13)18-14/h3-4,7-8,11,17H,5-6,9-10H2,1-2H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | RXKVQZAVXNUHAS-NSHDSACASA-N |
| XLogP | 1.86 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |