C15H21ClN4O — CID 71643020
3-methoxy-N-methyl-N-[(3R)-piperidin-3-yl]quinoxalin-2-amine;hydrochloride (PubChem CID 71643020) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 3-methoxy-N-methyl-N-[(3R)-piperidin-3-yl]quinoxalin-2-amine;hydrochloride.
| Compound Name | 3-methoxy-N-methyl-N-[(3R)-piperidin-3-yl]quinoxalin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 71643020 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-methoxy-N-methyl-N-[(3R)-piperidin-3-yl]quinoxalin-2-amine;hydrochloride |
| SMILES | COc1nc2ccccc2nc1N(C)[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C15H20N4O.ClH/c1-19(11-6-5-9-16-10-11)14-15(20-2)18-13-8-4-3-7-12(13)17-14;/h3-4,7-8,11,16H,5-6,9-10H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | ULJUTSORPNADDV-RFVHGSKJSA-N |
| XLogP | 2.25 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |