C15H21N5 — CID 97164701
3-N-[(1S,2S)-2-aminocyclohexyl]-2-N-methylquinoxaline-2,3-diamine (PubChem CID 97164701) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-N-[(1S,2S)-2-aminocyclohexyl]-2-N-methylquinoxaline-2,3-diamine.
| Compound Name | 3-N-[(1S,2S)-2-aminocyclohexyl]-2-N-methylquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 97164701 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-N-[(1S,2S)-2-aminocyclohexyl]-2-N-methylquinoxaline-2,3-diamine |
| SMILES | CNc1nc2ccccc2nc1N[C@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C15H21N5/c1-17-14-15(18-11-7-3-2-6-10(11)16)20-13-9-5-4-8-12(13)19-14/h4-5,8-11H,2-3,6-7,16H2,1H3,(H,17,19)(H,18,20)/t10-,11-/m0/s1 |
| InChIKey | APJSGMRXQRLAEM-QWRGUYRKSA-N |
| XLogP | 2.35 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |