C14H20ClN5 — CID 71644139
3-N-(2-aminocyclohexyl)quinoxaline-2,3-diamine;hydrochloride (PubChem CID 71644139) has the molecular formula C14H20ClN5 and a molecular weight of 293.80 g/mol. Its IUPAC name is 3-N-(2-aminocyclohexyl)quinoxaline-2,3-diamine;hydrochloride.
| Compound Name | 3-N-(2-aminocyclohexyl)quinoxaline-2,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 71644139 |
| Molecular Formula | C14H20ClN5 |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-N-(2-aminocyclohexyl)quinoxaline-2,3-diamine;hydrochloride |
| SMILES | Cl.Nc1nc2ccccc2nc1NC1CCCCC1N |
| InChI | InChI=1S/C14H19N5.ClH/c15-9-5-1-2-6-10(9)18-14-13(16)17-11-7-3-4-8-12(11)19-14;/h3-4,7-10H,1-2,5-6,15H2,(H2,16,17)(H,18,19);1H |
| InChIKey | ODCBDBBHSSHMNQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |