C14H17ClN4 — CID 71644138
2-N-(3-chloroquinoxalin-2-yl)cyclohexane-1,2-diamine (PubChem CID 71644138) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-N-(3-chloroquinoxalin-2-yl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(3-chloroquinoxalin-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71644138 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-N-(3-chloroquinoxalin-2-yl)cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C14H17ClN4/c15-13-14(18-10-6-2-1-5-9(10)16)19-12-8-4-3-7-11(12)17-13/h3-4,7-10H,1-2,5-6,16H2,(H,18,19) |
| InChIKey | NHOYSEKYWGVITL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |