C16H20N4O — CID 102738838
2-[[(1R,2R)-2-aminocyclohexyl]amino]quinoline-3-carboxamide (PubChem CID 102738838) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-aminocyclohexyl]amino]quinoline-3-carboxamide.
| Compound Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 102738838 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]quinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2ccccc2nc1N[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C16H20N4O/c17-12-6-2-4-8-14(12)20-16-11(15(18)21)9-10-5-1-3-7-13(10)19-16/h1,3,5,7,9,12,14H,2,4,6,8,17H2,(H2,18,21)(H,19,20)/t12-,14-/m1/s1 |
| InChIKey | LOXSOQDUECQRNB-TZMCWYRMSA-N |
| XLogP | 2.02 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |