C13H17F3N4O — CID 79875709
2-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79875709) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79875709 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[(2-aminocyclohexyl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1NC1CCCCC1N |
| InChI | InChI=1S/C13H17F3N4O/c14-13(15,16)10-6-5-7(11(18)21)12(20-10)19-9-4-2-1-3-8(9)17/h5-6,8-9H,1-4,17H2,(H2,18,21)(H,19,20) |
| InChIKey | IVDHIYPMBQLFSB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |