C11H12F3N3S — CID 79877582
2-[(2-methylcyclopropyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide (PubChem CID 79877582) has the molecular formula C11H12F3N3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 2-[(2-methylcyclopropyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide.
| Compound Name | 2-[(2-methylcyclopropyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79877582 |
| Molecular Formula | C11H12F3N3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-[(2-methylcyclopropyl)amino]-6-(trifluoromethyl)pyridine-3-carbothioamide |
| SMILES | CC1CC1Nc1nc(C(F)(F)F)ccc1C(N)=S |
| InChI | InChI=1S/C11H12F3N3S/c1-5-4-7(5)16-10-6(9(15)18)2-3-8(17-10)11(12,13)14/h2-3,5,7H,4H2,1H3,(H2,15,18)(H,16,17) |
| InChIKey | LCENFPKLBHHJSJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|