C15H20N4O — CID 71643079
2-N-(3-methoxyquinoxalin-2-yl)cyclohexane-1,2-diamine (PubChem CID 71643079) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-N-(3-methoxyquinoxalin-2-yl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(3-methoxyquinoxalin-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71643079 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-N-(3-methoxyquinoxalin-2-yl)cyclohexane-1,2-diamine |
| SMILES | COc1nc2ccccc2nc1NC1CCCCC1N |
| InChI | InChI=1S/C15H20N4O/c1-20-15-14(17-11-7-3-2-6-10(11)16)18-12-8-4-5-9-13(12)19-15/h4-5,8-11H,2-3,6-7,16H2,1H3,(H,17,18) |
| InChIKey | KCWGBCHUBKMRTO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |