C13H17N3S — CID 93453955
trans-(1R,2R)-2-N-(1,3-benzothiazol-2-yl)cyclohexane-1,2-diamine (PubChem CID 93453955) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-(1,3-benzothiazol-2-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-(1,3-benzothiazol-2-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 93453955 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | trans-(1R,2R)-2-N-(1,3-benzothiazol-2-yl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCC[C@H]1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17N3S/c14-9-5-1-2-6-10(9)15-13-16-11-7-3-4-8-12(11)17-13/h3-4,7-10H,1-2,5-6,14H2,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | BMFKWCQOWRDTPP-NXEZZACHSA-N |
| XLogP | 2.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |