C12H12N2S — CID 115695581
N-cyclopent-3-en-1-yl-1,3-benzothiazol-2-amine (PubChem CID 115695581) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-cyclopent-3-en-1-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 115695581 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-cyclopent-3-en-1-yl-1,3-benzothiazol-2-amine |
| SMILES | C1=CCC(Nc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C12H12N2S/c1-2-6-9(5-1)13-12-14-10-7-3-4-8-11(10)15-12/h1-4,7-9H,5-6H2,(H,13,14) |
| InChIKey | ZMPACSHYQHHHSZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|