C16H17N5S — CID 167960032
N-(1-pyridazin-3-ylpiperidin-4-yl)-1,3-benzothiazol-2-amine (PubChem CID 167960032) has the molecular formula C16H17N5S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(1-pyridazin-3-ylpiperidin-4-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(1-pyridazin-3-ylpiperidin-4-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 167960032 |
| Molecular Formula | C16H17N5S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-(1-pyridazin-3-ylpiperidin-4-yl)-1,3-benzothiazol-2-amine |
| SMILES | c1cnnc(N2CCC(Nc3nc4ccccc4s3)CC2)c1 |
| InChI | InChI=1S/C16H17N5S/c1-2-5-14-13(4-1)19-16(22-14)18-12-7-10-21(11-8-12)15-6-3-9-17-20-15/h1-6,9,12H,7-8,10-11H2,(H,18,19) |
| InChIKey | NWXPHLNBTGIXSZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |