C14H19N3S — CID 51983203
N-[(3R)-1-ethylpiperidin-3-yl]-1,3-benzothiazol-2-amine (PubChem CID 51983203) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(3R)-1-ethylpiperidin-3-yl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(3R)-1-ethylpiperidin-3-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 51983203 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(3R)-1-ethylpiperidin-3-yl]-1,3-benzothiazol-2-amine |
| SMILES | CCN1CCC[C@@H](Nc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C14H19N3S/c1-2-17-9-5-6-11(10-17)15-14-16-12-7-3-4-8-13(12)18-14/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | FMHOVBNOQUQOEE-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |