C16H21N3O2S — CID 96578679
ethyl (3S)-3-(1,3-benzothiazol-2-ylamino)azepane-1-carboxylate (PubChem CID 96578679) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl (3S)-3-(1,3-benzothiazol-2-ylamino)azepane-1-carboxylate.
| Compound Name | ethyl (3S)-3-(1,3-benzothiazol-2-ylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 96578679 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl (3S)-3-(1,3-benzothiazol-2-ylamino)azepane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC[C@H](Nc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C16H21N3O2S/c1-2-21-16(20)19-10-6-5-7-12(11-19)17-15-18-13-8-3-4-9-14(13)22-15/h3-4,8-9,12H,2,5-7,10-11H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | ZWJGJCNXTRZFNO-LBPRGKRZSA-N |
| XLogP | 3.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |