C19H28IN5O2S — CID 111156382
ethyl 1-[N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156382) has the molecular formula C19H28IN5O2S and a molecular weight of 517.44 g/mol. Its IUPAC name is ethyl 1-[N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156382 |
| Molecular Formula | C19H28IN5O2S |
| Molecular Weight | 517.44 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | ethyl 1-[N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCN(/C(=N\C)NCCNc2nc3ccccc3s2)CC1.I |
| InChI | InChI=1S/C19H27N5O2S.HI/c1-3-26-17(25)14-8-12-24(13-9-14)18(20-2)21-10-11-22-19-23-15-6-4-5-7-16(15)27-19;/h4-7,14H,3,8-13H2,1-2H3,(H,20,21)(H,22,23);1H |
| InChIKey | XWRLTBSICISSEF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|