C16H19N5S — CID 133330150
N-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-1,3-benzothiazol-2-amine (PubChem CID 133330150) has the molecular formula C16H19N5S and a molecular weight of 313.43 g/mol. Its IUPAC name is N-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 133330150 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-1,3-benzothiazol-2-amine |
| SMILES | Cn1cc(N2CCCC(Nc3nc4ccccc4s3)C2)cn1 |
| InChI | InChI=1S/C16H19N5S/c1-20-11-13(9-17-20)21-8-4-5-12(10-21)18-16-19-14-6-2-3-7-15(14)22-16/h2-3,6-7,9,11-12H,4-5,8,10H2,1H3,(H,18,19) |
| InChIKey | BYLZSIUWSQMPRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |