C15H18N6 — CID 99848388
5-[[(3S)-1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]pyridine-2-carbonitrile (PubChem CID 99848388) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 5-[[(3S)-1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[(3S)-1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 99848388 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 5-[[(3S)-1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]pyridine-2-carbonitrile |
| SMILES | Cn1cc(N2CCC[C@H](Nc3ccc(C#N)nc3)C2)cn1 |
| InChI | InChI=1S/C15H18N6/c1-20-11-15(9-18-20)21-6-2-3-14(10-21)19-13-5-4-12(7-16)17-8-13/h4-5,8-9,11,14,19H,2-3,6,10H2,1H3/t14-/m0/s1 |
| InChIKey | DTSGEJRRYTXMFI-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |