C11H14N4 — CID 115490388
5-(piperidin-3-ylamino)pyridine-2-carbonitrile (PubChem CID 115490388) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-(piperidin-3-ylamino)pyridine-2-carbonitrile.
| Compound Name | 5-(piperidin-3-ylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 115490388 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-(piperidin-3-ylamino)pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCCNC2)cn1 |
| InChI | InChI=1S/C11H14N4/c12-6-9-3-4-11(8-14-9)15-10-2-1-5-13-7-10/h3-4,8,10,13,15H,1-2,5,7H2 |
| InChIKey | QRIFVIGQZWSMBJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |