C14H15N5 — CID 168932124
7-[[(3S)-piperidin-3-yl]amino]-2,6-naphthyridine-3-carbonitrile (PubChem CID 168932124) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 7-[[(3S)-piperidin-3-yl]amino]-2,6-naphthyridine-3-carbonitrile.
| Compound Name | 7-[[(3S)-piperidin-3-yl]amino]-2,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168932124 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 7-[[(3S)-piperidin-3-yl]amino]-2,6-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cc2cnc(N[C@H]3CCCNC3)cc2cn1 |
| InChI | InChI=1S/C14H15N5/c15-6-13-4-10-8-18-14(5-11(10)7-17-13)19-12-2-1-3-16-9-12/h4-5,7-8,12,16H,1-3,9H2,(H,18,19)/t12-/m0/s1 |
| InChIKey | WJRTYMJWOQVKET-LBPRGKRZSA-N |
| XLogP | 1.67 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |