C19H19N7O2 — CID 133330073
2-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]-6-nitroquinoline-4-carbonitrile (PubChem CID 133330073) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133330073 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[[1-(1-methylpyrazol-4-yl)piperidin-3-yl]amino]-6-nitroquinoline-4-carbonitrile |
| SMILES | Cn1cc(N2CCCC(Nc3cc(C#N)c4cc([N+](=O)[O-])ccc4n3)C2)cn1 |
| InChI | InChI=1S/C19H19N7O2/c1-24-12-16(10-21-24)25-6-2-3-14(11-25)22-19-7-13(9-20)17-8-15(26(27)28)4-5-18(17)23-19/h4-5,7-8,10,12,14H,2-3,6,11H2,1H3,(H,22,23) |
| InChIKey | SCGGLEGTKQOSLI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|