C21H25N5O2 — CID 133454385
2-[3-(azepan-1-yl)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile (PubChem CID 133454385) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[3-(azepan-1-yl)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[3-(azepan-1-yl)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133454385 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-[3-(azepan-1-yl)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile |
| SMILES | N#Cc1cc(N2CCCC(N3CCCCCC3)C2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H25N5O2/c22-14-16-12-21(23-20-8-7-17(26(27)28)13-19(16)20)25-11-5-6-18(15-25)24-9-3-1-2-4-10-24/h7-8,12-13,18H,1-6,9-11,15H2 |
| InChIKey | METJYZHEDQQAJG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|