C19H20N4O2 — CID 133463918
2-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-nitroquinoline-4-carbonitrile (PubChem CID 133463918) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133463918 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(3-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-6-nitroquinoline-4-carbonitrile |
| SMILES | CC1CN(c2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)C2CCCCC12 |
| InChI | InChI=1S/C19H20N4O2/c1-12-11-22(18-5-3-2-4-15(12)18)19-8-13(10-20)16-9-14(23(24)25)6-7-17(16)21-19/h6-9,12,15,18H,2-5,11H2,1H3 |
| InChIKey | LRYWXIPCIUQPTA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|