C16H16N4O3 — CID 133310884
2-(2,2-dimethylmorpholin-4-yl)-6-nitroquinoline-4-carbonitrile (PubChem CID 133310884) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-(2,2-dimethylmorpholin-4-yl)-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-(2,2-dimethylmorpholin-4-yl)-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133310884 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(2,2-dimethylmorpholin-4-yl)-6-nitroquinoline-4-carbonitrile |
| SMILES | CC1(C)CN(c2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)CCO1 |
| InChI | InChI=1S/C16H16N4O3/c1-16(2)10-19(5-6-23-16)15-7-11(9-17)13-8-12(20(21)22)3-4-14(13)18-15/h3-4,7-8H,5-6,10H2,1-2H3 |
| InChIKey | PWYLVIMPCPPDEH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|