C19H21N5O4 — CID 133346352
ethyl 2-[4-(4-cyano-6-nitroquinolin-2-yl)-1,4-diazepan-1-yl]acetate (PubChem CID 133346352) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is ethyl 2-[4-(4-cyano-6-nitroquinolin-2-yl)-1,4-diazepan-1-yl]acetate.
| Compound Name | ethyl 2-[4-(4-cyano-6-nitroquinolin-2-yl)-1,4-diazepan-1-yl]acetate |
|---|---|
| PubChem CID | 133346352 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | ethyl 2-[4-(4-cyano-6-nitroquinolin-2-yl)-1,4-diazepan-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCCN(c2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)CC1 |
| InChI | InChI=1S/C19H21N5O4/c1-2-28-19(25)13-22-6-3-7-23(9-8-22)18-10-14(12-20)16-11-15(24(26)27)4-5-17(16)21-18/h4-5,10-11H,2-3,6-9,13H2,1H3 |
| InChIKey | OVWOSPGQIRMAOR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 112.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|