C21H16F2N4O3 — CID 133318466
2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile (PubChem CID 133318466) has the molecular formula C21H16F2N4O3 and a molecular weight of 410.38 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 133318466 |
| Molecular Formula | C21H16F2N4O3 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-6-nitroquinoline-4-carbonitrile |
| SMILES | N#Cc1cc(N2CCC(Oc3ccc(F)cc3F)CC2)nc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H16F2N4O3/c22-14-1-4-20(18(23)10-14)30-16-5-7-26(8-6-16)21-9-13(12-24)17-11-15(27(28)29)2-3-19(17)25-21/h1-4,9-11,16H,5-8H2 |
| InChIKey | KKAXVFKEOMDIMJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|