C21H25N5O4 — CID 133395636
tert-butyl N-[1-(4-cyano-6-nitroquinolin-2-yl)-2-methylpiperidin-4-yl]carbamate (PubChem CID 133395636) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is tert-butyl N-[1-(4-cyano-6-nitroquinolin-2-yl)-2-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-cyano-6-nitroquinolin-2-yl)-2-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 133395636 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | tert-butyl N-[1-(4-cyano-6-nitroquinolin-2-yl)-2-methylpiperidin-4-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CCN1c1cc(C#N)c2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C21H25N5O4/c1-13-9-15(23-20(27)30-21(2,3)4)7-8-25(13)19-10-14(12-22)17-11-16(26(28)29)5-6-18(17)24-19/h5-6,10-11,13,15H,7-9H2,1-4H3,(H,23,27) |
| InChIKey | VKNHLIWCSLNSIK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|