C21H29N5O2 — CID 133395581
tert-butyl N-[2-methyl-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-4-yl]carbamate (PubChem CID 133395581) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 133395581 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl N-[2-methyl-1-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperidin-4-yl]carbamate |
| SMILES | Cc1cc(N2CCC(NC(=O)OC(C)(C)C)CC2C)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H29N5O2/c1-14-11-18(25-19(23-14)16-7-6-9-22-13-16)26-10-8-17(12-15(26)2)24-20(27)28-21(3,4)5/h6-7,9,11,13,15,17H,8,10,12H2,1-5H3,(H,24,27) |
| InChIKey | IEHJCHIQLWROHT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |