C19H32N4O2 — CID 133395545
tert-butyl N-[1-(2-tert-butylpyrimidin-4-yl)-2-methylpiperidin-4-yl]carbamate (PubChem CID 133395545) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl N-[1-(2-tert-butylpyrimidin-4-yl)-2-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-tert-butylpyrimidin-4-yl)-2-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 133395545 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | tert-butyl N-[1-(2-tert-butylpyrimidin-4-yl)-2-methylpiperidin-4-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CCN1c1ccnc(C(C)(C)C)n1 |
| InChI | InChI=1S/C19H32N4O2/c1-13-12-14(21-17(24)25-19(5,6)7)9-11-23(13)15-8-10-20-16(22-15)18(2,3)4/h8,10,13-14H,9,11-12H2,1-7H3,(H,21,24) |
| InChIKey | HJJNXMQUUZTYJR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |